C24H25FN4O2 — CID 10364826
N-[4-[2-(4-fluoroanilino)-4-pyridinyl]-2-pyridinyl]-4-methoxycyclohexane-1-carboxamide (PubChem CID 10364826) has the molecular formula C24H25FN4O2 and a molecular weight of 420.49 g/mol. Its IUPAC name is N-[4-[2-(4-fluoroanilino)-4-pyridinyl]-2-pyridinyl]-4-methoxycyclohexane-1-carboxamide.
| Compound Name | N-[4-[2-(4-fluoroanilino)-4-pyridinyl]-2-pyridinyl]-4-methoxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 10364826 |
| Molecular Formula | C24H25FN4O2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | N-[4-[2-(4-fluoroanilino)-4-pyridinyl]-2-pyridinyl]-4-methoxycyclohexane-1-carboxamide |
| SMILES | COC1CCC(C(=O)Nc2cc(-c3ccnc(Nc4ccc(F)cc4)c3)ccn2)CC1 |
| InChI | InChI=1S/C24H25FN4O2/c1-31-21-8-2-16(3-9-21)24(30)29-23-15-18(11-13-27-23)17-10-12-26-22(14-17)28-20-6-4-19(25)5-7-20/h4-7,10-16,21H,2-3,8-9H2,1H3,(H,26,28)(H,27,29,30) |
| InChIKey | ACGBFWCBVIXTPZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |