C8H16N2O3 — CID 103650627
2-[(2-methoxyacetyl)amino]-3-methylbutanamide (PubChem CID 103650627) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-[(2-methoxyacetyl)amino]-3-methylbutanamide.
| Compound Name | 2-[(2-methoxyacetyl)amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 103650627 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 2-[(2-methoxyacetyl)amino]-3-methylbutanamide |
| SMILES | COCC(=O)NC(C(N)=O)C(C)C |
| InChI | InChI=1S/C8H16N2O3/c1-5(2)7(8(9)12)10-6(11)4-13-3/h5,7H,4H2,1-3H3,(H2,9,12)(H,10,11) |
| InChIKey | VZUPFWJQIMWGQA-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |