C20H38N6O4 — CID 10365153
(2S,3S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-methylpentanamide (PubChem CID 10365153) has the molecular formula C20H38N6O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is (2S,3S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-methylpentanamide.
| Compound Name | (2S,3S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-methylpentanamide |
|---|---|
| PubChem CID | 10365153 |
| Molecular Formula | C20H38N6O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | (2S,3S)-2-[[(2S)-2-acetamido-4-methylpentanoyl]amino]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-3-methylpentanamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CC(C)C)NC(C)=O)C(=O)N[C@H](C=O)CCCN=C(N)N |
| InChI | InChI=1S/C20H38N6O4/c1-6-13(4)17(26-18(29)16(10-12(2)3)24-14(5)28)19(30)25-15(11-27)8-7-9-23-20(21)22/h11-13,15-17H,6-10H2,1-5H3,(H,24,28)(H,25,30)(H,26,29)(H4,21,22,23)/t13-,15-,16-,17-/m0/s1 |
| InChIKey | FVYMUBVDOSCORG-HJWJTTGWSA-N |
| XLogP | -0.19 |
| TPSA | 168.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|