About N-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-9H-acridine-10-carboxamide
N-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-9H-acridine-10-carboxamide (PubChem CID 10365224) has the molecular formula C27H29N3O2
and a molecular weight of 427.55 g/mol. Its IUPAC name is N-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-9H-acridine-10-carboxamide.
Molecular Properties
| Compound Name | N-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-9H-acridine-10-carboxamide |
| PubChem CID | 10365224 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | N-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-9H-acridine-10-carboxamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NC(=O)N1c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C27H29N3O2/c1-17(2)21-12-9-13-22(18(3)4)25(21)28-26(31)29-27(32)30-23-14-7-5-10-19(23)16-20-11-6-8-15-24(20)30/h5-15,17-18H,16H2,1-4H3,(H2,28,29,31,32) |
| InChIKey | BRBZRNXMSMPAIN-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-9H-acridine-10-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-9H-acridine-10-carboxamide?
The IUPAC name of N-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-9H-acridine-10-carboxamide (CID 10365224) is N-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-9H-acridine-10-carboxamide.
What is the SMILES notation for N-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-9H-acridine-10-carboxamide?
The canonical SMILES for N-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-9H-acridine-10-carboxamide is CC(C)c1cccc(C(C)C)c1NC(=O)NC(=O)N1c2ccccc2Cc2ccccc21.
What is the InChIKey of N-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-9H-acridine-10-carboxamide?
The InChIKey is BRBZRNXMSMPAIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H29N3O2/c1-17(2)21-12-9-13-22(18(3)4)25(21)28-26(31)29-27(32)30-23-14-7-5-10-19(23)16-20-11-6-8-15-24(20)30/h5-15,17-18H,16H2,1-4H3,(H2,28,29,31,32).
What are the key properties of N-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-9H-acridine-10-carboxamide?
N-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-9H-acridine-10-carboxamide has a molecular weight of 427.55 g/mol, XLogP of 6.92, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2,6-di(propan-2-yl)phenyl]carbamoyl]-9H-acridine-10-carboxamide is sourced from PubChem (CID 10365224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).