C26H28N4O2 — CID 10365283
2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-methylanilino]-2-phenylacetic acid (PubChem CID 10365283) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-methylanilino]-2-phenylacetic acid.
| Compound Name | 2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-methylanilino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 10365283 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-methylanilino]-2-phenylacetic acid |
| SMILES | CCc1nc2c(C)cc(C)nc2n1Cc1ccc(N(C)C(C(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H28N4O2/c1-5-22-28-23-17(2)15-18(3)27-25(23)30(22)16-19-11-13-21(14-12-19)29(4)24(26(31)32)20-9-7-6-8-10-20/h6-15,24H,5,16H2,1-4H3,(H,31,32) |
| InChIKey | SLDCMEISYKBOIQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|