C23H30O2S2Si — CID 10365422
[2-[1-(1,3-dioxolan-2-yl)propan-2-yl]-1,3-dithian-2-yl]-methyl-diphenylsilane (PubChem CID 10365422) has the molecular formula C23H30O2S2Si and a molecular weight of 430.71 g/mol. Its IUPAC name is [2-[1-(1,3-dioxolan-2-yl)propan-2-yl]-1,3-dithian-2-yl]-methyl-diphenylsilane.
| Compound Name | [2-[1-(1,3-dioxolan-2-yl)propan-2-yl]-1,3-dithian-2-yl]-methyl-diphenylsilane |
|---|---|
| PubChem CID | 10365422 |
| Molecular Formula | C23H30O2S2Si |
| Molecular Weight | 430.71 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | [2-[1-(1,3-dioxolan-2-yl)propan-2-yl]-1,3-dithian-2-yl]-methyl-diphenylsilane |
| SMILES | CC(CC1OCCO1)C1([Si](C)(c2ccccc2)c2ccccc2)SCCCS1 |
| InChI | InChI=1S/C23H30O2S2Si/c1-19(18-22-24-14-15-25-22)23(26-16-9-17-27-23)28(2,20-10-5-3-6-11-20)21-12-7-4-8-13-21/h3-8,10-13,19,22H,9,14-18H2,1-2H3 |
| InChIKey | JNEMZFSJKBPYPX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.71 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|