C19H27F2N2O5P — CID 10365504
6-[(5S)-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]hexylphosphonic acid (PubChem CID 10365504) has the molecular formula C19H27F2N2O5P and a molecular weight of 432.40 g/mol. Its IUPAC name is 6-[(5S)-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]hexylphosphonic acid.
| Compound Name | 6-[(5S)-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]hexylphosphonic acid |
|---|---|
| PubChem CID | 10365504 |
| Molecular Formula | C19H27F2N2O5P |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 6-[(5S)-5-[(E)-4,4-difluoro-3-hydroxy-4-phenylbut-1-enyl]-2-oxoimidazolidin-1-yl]hexylphosphonic acid |
| SMILES | O=C1NC[C@H](/C=C/C(O)C(F)(F)c2ccccc2)N1CCCCCCP(=O)(O)O |
| InChI | InChI=1S/C19H27F2N2O5P/c20-19(21,15-8-4-3-5-9-15)17(24)11-10-16-14-22-18(25)23(16)12-6-1-2-7-13-29(26,27)28/h3-5,8-11,16-17,24H,1-2,6-7,12-14H2,(H,22,25)(H2,26,27,28)/b11-10+/t16-,17?/m0/s1 |
| InChIKey | XVQLSAFQWSUONJ-YSTYDPQKSA-N |
| XLogP | 2.83 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|