C22H45FO3Si2 — CID 10365542
[(4R,5R,6R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(3-fluoropropyl)cyclohexen-1-yl]methanol (PubChem CID 10365542) has the molecular formula C22H45FO3Si2 and a molecular weight of 432.77 g/mol. Its IUPAC name is [(4R,5R,6R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(3-fluoropropyl)cyclohexen-1-yl]methanol.
| Compound Name | [(4R,5R,6R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(3-fluoropropyl)cyclohexen-1-yl]methanol |
|---|---|
| PubChem CID | 10365542 |
| Molecular Formula | C22H45FO3Si2 |
| Molecular Weight | 432.77 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | [(4R,5R,6R)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(3-fluoropropyl)cyclohexen-1-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC=C(CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CCCF |
| InChI | InChI=1S/C22H45FO3Si2/c1-21(2,3)27(7,8)25-19-14-13-17(16-24)20(18(19)12-11-15-23)26-28(9,10)22(4,5)6/h13,18-20,24H,11-12,14-16H2,1-10H3/t18-,19-,20+/m1/s1 |
| InChIKey | DMNLFEGCFLLUNK-AQNXPRMDSA-N |
| XLogP | 6.46 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.77 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|