C22H28BrNO3 — CID 10365607
2-(3-bromo-4-methoxyphenyl)-N-[1-(3-methoxyphenyl)hexan-2-yl]acetamide (PubChem CID 10365607) has the molecular formula C22H28BrNO3 and a molecular weight of 434.37 g/mol. Its IUPAC name is 2-(3-bromo-4-methoxyphenyl)-N-[1-(3-methoxyphenyl)hexan-2-yl]acetamide.
| Compound Name | 2-(3-bromo-4-methoxyphenyl)-N-[1-(3-methoxyphenyl)hexan-2-yl]acetamide |
|---|---|
| PubChem CID | 10365607 |
| Molecular Formula | C22H28BrNO3 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-(3-bromo-4-methoxyphenyl)-N-[1-(3-methoxyphenyl)hexan-2-yl]acetamide |
| SMILES | CCCCC(Cc1cccc(OC)c1)NC(=O)Cc1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C22H28BrNO3/c1-4-5-8-18(12-16-7-6-9-19(13-16)26-2)24-22(25)15-17-10-11-21(27-3)20(23)14-17/h6-7,9-11,13-14,18H,4-5,8,12,15H2,1-3H3,(H,24,25) |
| InChIKey | FFZRYLQPITUEQM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |