C17H25F3N6O4 — CID 10365609
2-[2-[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]hydrazinyl]-N,N-dimethyl-4-(trifluoromethyl)pyrimidine-5-carboxamide (PubChem CID 10365609) has the molecular formula C17H25F3N6O4 and a molecular weight of 434.42 g/mol. Its IUPAC name is 2-[2-[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]hydrazinyl]-N,N-dimethyl-4-(trifluoromethyl)pyrimidine-5-carboxamide.
| Compound Name | 2-[2-[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]hydrazinyl]-N,N-dimethyl-4-(trifluoromethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 10365609 |
| Molecular Formula | C17H25F3N6O4 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 2-[2-[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]hydrazinyl]-N,N-dimethyl-4-(trifluoromethyl)pyrimidine-5-carboxamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NNc1ncc(C(=O)N(C)C)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C17H25F3N6O4/c1-4-5-6-7-11(9-26(30)10-27)14(28)23-24-16-21-8-12(15(29)25(2)3)13(22-16)17(18,19)20/h8,10-11,30H,4-7,9H2,1-3H3,(H,23,28)(H,21,22,24)/t11-/m1/s1 |
| InChIKey | JLZDPACSEXHVMY-LLVKDONJSA-N |
| XLogP | 1.68 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|