C11H24N2O2 — CID 103657880
1-(3-ethyl-2-hydroxypentyl)-3-propylurea (PubChem CID 103657880) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 1-(3-ethyl-2-hydroxypentyl)-3-propylurea.
| Compound Name | 1-(3-ethyl-2-hydroxypentyl)-3-propylurea |
|---|---|
| PubChem CID | 103657880 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 1-(3-ethyl-2-hydroxypentyl)-3-propylurea |
| SMILES | CCCNC(=O)NCC(O)C(CC)CC |
| InChI | InChI=1S/C11H24N2O2/c1-4-7-12-11(15)13-8-10(14)9(5-2)6-3/h9-10,14H,4-8H2,1-3H3,(H2,12,13,15) |
| InChIKey | YIDNIJKCKNRGSC-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |