C26H15ClN2O3 — CID 10365888
16-(4-chlorophenyl)imino-5-methyl-8,13-dioxa-2-azapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),5,10,14,17,19,21-nonaen-7-one (PubChem CID 10365888) has the molecular formula C26H15ClN2O3 and a molecular weight of 438.87 g/mol. Its IUPAC name is 16-(4-chlorophenyl)imino-5-methyl-8,13-dioxa-2-azapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),5,10,14,17,19,21-nonaen-7-one.
| Compound Name | 16-(4-chlorophenyl)imino-5-methyl-8,13-dioxa-2-azapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),5,10,14,17,19,21-nonaen-7-one |
|---|---|
| PubChem CID | 10365888 |
| Molecular Formula | C26H15ClN2O3 |
| Molecular Weight | 438.87 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 16-(4-chlorophenyl)imino-5-methyl-8,13-dioxa-2-azapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),5,10,14,17,19,21-nonaen-7-one |
| SMILES | Cc1cc(=O)oc2ccc3oc4c/c(=N\c5ccc(Cl)cc5)c5ccccc5c-4nc3c12 |
| InChI | InChI=1S/C26H15ClN2O3/c1-14-12-23(30)32-20-10-11-21-26(24(14)20)29-25-18-5-3-2-4-17(18)19(13-22(25)31-21)28-16-8-6-15(27)7-9-16/h2-13H,1H3/b28-19+ |
| InChIKey | DVFYDQSYKGUKBF-TURZUDJPSA-N |
| XLogP | 6.39 |
| TPSA | 68.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.87 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|