About 2-(2-acridin-9-yl-4-methyl-1,3-thiazol-5-yl)ethyl 4-aminobenzoate
2-(2-acridin-9-yl-4-methyl-1,3-thiazol-5-yl)ethyl 4-aminobenzoate (PubChem CID 10365925) has the molecular formula C26H21N3O2S
and a molecular weight of 439.54 g/mol. Its IUPAC name is 2-(2-acridin-9-yl-4-methyl-1,3-thiazol-5-yl)ethyl 4-aminobenzoate.
Molecular Properties
| Compound Name | 2-(2-acridin-9-yl-4-methyl-1,3-thiazol-5-yl)ethyl 4-aminobenzoate |
| PubChem CID | 10365925 |
| Molecular Formula | C26H21N3O2S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 2-(2-acridin-9-yl-4-methyl-1,3-thiazol-5-yl)ethyl 4-aminobenzoate |
| SMILES | Cc1nc(-c2c3ccccc3nc3ccccc23)sc1CCOC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C26H21N3O2S/c1-16-23(14-15-31-26(30)17-10-12-18(27)13-11-17)32-25(28-16)24-19-6-2-4-8-21(19)29-22-9-5-3-7-20(22)24/h2-13H,14-15,27H2,1H3 |
| InChIKey | CFUNUNVAKSCZGW-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-acridin-9-yl-4-methyl-1,3-thiazol-5-yl)ethyl 4-aminobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-acridin-9-yl-4-methyl-1,3-thiazol-5-yl)ethyl 4-aminobenzoate?
The IUPAC name of 2-(2-acridin-9-yl-4-methyl-1,3-thiazol-5-yl)ethyl 4-aminobenzoate (CID 10365925) is 2-(2-acridin-9-yl-4-methyl-1,3-thiazol-5-yl)ethyl 4-aminobenzoate.
What is the SMILES notation for 2-(2-acridin-9-yl-4-methyl-1,3-thiazol-5-yl)ethyl 4-aminobenzoate?
The canonical SMILES for 2-(2-acridin-9-yl-4-methyl-1,3-thiazol-5-yl)ethyl 4-aminobenzoate is Cc1nc(-c2c3ccccc3nc3ccccc23)sc1CCOC(=O)c1ccc(N)cc1.
What is the InChIKey of 2-(2-acridin-9-yl-4-methyl-1,3-thiazol-5-yl)ethyl 4-aminobenzoate?
The InChIKey is CFUNUNVAKSCZGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21N3O2S/c1-16-23(14-15-31-26(30)17-10-12-18(27)13-11-17)32-25(28-16)24-19-6-2-4-8-21(19)29-22-9-5-3-7-20(22)24/h2-13H,14-15,27H2,1H3.
What are the key properties of 2-(2-acridin-9-yl-4-methyl-1,3-thiazol-5-yl)ethyl 4-aminobenzoate?
2-(2-acridin-9-yl-4-methyl-1,3-thiazol-5-yl)ethyl 4-aminobenzoate has a molecular weight of 439.54 g/mol, XLogP of 5.80, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-acridin-9-yl-4-methyl-1,3-thiazol-5-yl)ethyl 4-aminobenzoate is sourced from PubChem (CID 10365925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).