C24H30N2O6 — CID 10366067
[2-(cyclopropylamino)-2-oxoethyl] N-[3-[5-(6-methoxynaphthalen-1-yl)-1,3-dioxan-2-yl]propyl]carbamate (PubChem CID 10366067) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] N-[3-[5-(6-methoxynaphthalen-1-yl)-1,3-dioxan-2-yl]propyl]carbamate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] N-[3-[5-(6-methoxynaphthalen-1-yl)-1,3-dioxan-2-yl]propyl]carbamate |
|---|---|
| PubChem CID | 10366067 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] N-[3-[5-(6-methoxynaphthalen-1-yl)-1,3-dioxan-2-yl]propyl]carbamate |
| SMILES | COc1ccc2c(C3COC(CCCNC(=O)OCC(=O)NC4CC4)OC3)cccc2c1 |
| InChI | InChI=1S/C24H30N2O6/c1-29-19-9-10-21-16(12-19)4-2-5-20(21)17-13-30-23(31-14-17)6-3-11-25-24(28)32-15-22(27)26-18-7-8-18/h2,4-5,9-10,12,17-18,23H,3,6-8,11,13-15H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | HYFWBEVSCWFXPP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|