C9H18N2O2 — CID 103663303
3-(methoxymethyl)-N-methylpiperidine-1-carboxamide (PubChem CID 103663303) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 3-(methoxymethyl)-N-methylpiperidine-1-carboxamide.
| Compound Name | 3-(methoxymethyl)-N-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 103663303 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 3-(methoxymethyl)-N-methylpiperidine-1-carboxamide |
| SMILES | CNC(=O)N1CCCC(COC)C1 |
| InChI | InChI=1S/C9H18N2O2/c1-10-9(12)11-5-3-4-8(6-11)7-13-2/h8H,3-7H2,1-2H3,(H,10,12) |
| InChIKey | KBVQFSJLHDEHQJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |