C19H27F2N3O5S — CID 10366341
4-[4-[5-(2,2-difluoropropyl)-2-pyridinyl]piperidin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 10366341) has the molecular formula C19H27F2N3O5S and a molecular weight of 447.50 g/mol. Its IUPAC name is 4-[4-[5-(2,2-difluoropropyl)-2-pyridinyl]piperidin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-[5-(2,2-difluoropropyl)-2-pyridinyl]piperidin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 10366341 |
| Molecular Formula | C19H27F2N3O5S |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 4-[4-[5-(2,2-difluoropropyl)-2-pyridinyl]piperidin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | CC(F)(F)Cc1ccc(C2CCN(S(=O)(=O)C3(C(=O)NO)CCOCC3)CC2)nc1 |
| InChI | InChI=1S/C19H27F2N3O5S/c1-18(20,21)12-14-2-3-16(22-13-14)15-4-8-24(9-5-15)30(27,28)19(17(25)23-26)6-10-29-11-7-19/h2-3,13,15,26H,4-12H2,1H3,(H,23,25) |
| InChIKey | UOQNYQGOZZNUTK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|