C24H22N2O7 — CID 10366490
2,3,7,8-tetramethoxy-5-[(4-nitrophenyl)methyl]phenanthridin-6-one (PubChem CID 10366490) has the molecular formula C24H22N2O7 and a molecular weight of 450.45 g/mol. Its IUPAC name is 2,3,7,8-tetramethoxy-5-[(4-nitrophenyl)methyl]phenanthridin-6-one.
| Compound Name | 2,3,7,8-tetramethoxy-5-[(4-nitrophenyl)methyl]phenanthridin-6-one |
|---|---|
| PubChem CID | 10366490 |
| Molecular Formula | C24H22N2O7 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 2,3,7,8-tetramethoxy-5-[(4-nitrophenyl)methyl]phenanthridin-6-one |
| SMILES | COc1cc2c3ccc(OC)c(OC)c3c(=O)n(Cc3ccc([N+](=O)[O-])cc3)c2cc1OC |
| InChI | InChI=1S/C24H22N2O7/c1-30-19-10-9-16-17-11-20(31-2)21(32-3)12-18(17)25(24(27)22(16)23(19)33-4)13-14-5-7-15(8-6-14)26(28)29/h5-12H,13H2,1-4H3 |
| InChIKey | PHLZCZLSMDZUSR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 102.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|