C31H52O2 — CID 10366822
ethyl 2-[(1S,2R,5R,7S,8R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-7-pentacyclo[8.7.0.02,8.05,8.011,15]heptadecanyl]acetate (PubChem CID 10366822) has the molecular formula C31H52O2 and a molecular weight of 456.76 g/mol. Its IUPAC name is ethyl 2-[(1S,2R,5R,7S,8R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-7-pentacyclo[8.7.0.02,8.05,8.011,15]heptadecanyl]acetate.
| Compound Name | ethyl 2-[(1S,2R,5R,7S,8R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-7-pentacyclo[8.7.0.02,8.05,8.011,15]heptadecanyl]acetate |
|---|---|
| PubChem CID | 10366822 |
| Molecular Formula | C31H52O2 |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 456.40 |
| IUPAC Name | ethyl 2-[(1S,2R,5R,7S,8R,10S,11S,14R,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]-7-pentacyclo[8.7.0.02,8.05,8.011,15]heptadecanyl]acetate |
| SMILES | CCOC(=O)C[C@@H]1C[C@H]2CC[C@]3(C)[C@H]4CC[C@]5(C)[C@@H]([C@H](C)CCCC(C)C)CC[C@H]5[C@@H]4C[C@@]213 |
| InChI | InChI=1S/C31H52O2/c1-7-33-28(32)18-23-17-22-13-16-30(6)27-14-15-29(5)25(21(4)10-8-9-20(2)3)11-12-26(29)24(27)19-31(22,23)30/h20-27H,7-19H2,1-6H3/t21-,22-,23+,24+,25-,26+,27+,29-,30-,31-/m1/s1 |
| InChIKey | OSYOJEQBCIZCOD-GDXCOLRISA-N |
| XLogP | 8.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |