C13H13Br3O3 — CID 10366827
(2R)-2-[(2,3,6-tribromo-4,5-dihydroxyphenyl)methyl]cyclohexan-1-one (PubChem CID 10366827) has the molecular formula C13H13Br3O3 and a molecular weight of 456.96 g/mol. Its IUPAC name is (2R)-2-[(2,3,6-tribromo-4,5-dihydroxyphenyl)methyl]cyclohexan-1-one.
| Compound Name | (2R)-2-[(2,3,6-tribromo-4,5-dihydroxyphenyl)methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 10366827 |
| Molecular Formula | C13H13Br3O3 |
| Molecular Weight | 456.96 g/mol |
| Exact Mass | 453.84 |
| IUPAC Name | (2R)-2-[(2,3,6-tribromo-4,5-dihydroxyphenyl)methyl]cyclohexan-1-one |
| SMILES | O=C1CCCC[C@@H]1Cc1c(Br)c(O)c(O)c(Br)c1Br |
| InChI | InChI=1S/C13H13Br3O3/c14-9-7(5-6-3-1-2-4-8(6)17)10(15)12(18)13(19)11(9)16/h6,18-19H,1-5H2/t6-/m1/s1 |
| InChIKey | LLMBLIAKCCQZSI-ZCFIWIBFSA-N |
| XLogP | 4.69 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.96 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|