C27H38N6O — CID 10367104
1-[2-(dimethylamino)-6-[3-(5-methyl-4-phenylimidazol-1-yl)propylamino]phenyl]-3-pentylurea (PubChem CID 10367104) has the molecular formula C27H38N6O and a molecular weight of 462.64 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-6-[3-(5-methyl-4-phenylimidazol-1-yl)propylamino]phenyl]-3-pentylurea.
| Compound Name | 1-[2-(dimethylamino)-6-[3-(5-methyl-4-phenylimidazol-1-yl)propylamino]phenyl]-3-pentylurea |
|---|---|
| PubChem CID | 10367104 |
| Molecular Formula | C27H38N6O |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.31 |
| IUPAC Name | 1-[2-(dimethylamino)-6-[3-(5-methyl-4-phenylimidazol-1-yl)propylamino]phenyl]-3-pentylurea |
| SMILES | CCCCCNC(=O)Nc1c(NCCCn2cnc(-c3ccccc3)c2C)cccc1N(C)C |
| InChI | InChI=1S/C27H38N6O/c1-5-6-10-17-29-27(34)31-26-23(15-11-16-24(26)32(3)4)28-18-12-19-33-20-30-25(21(33)2)22-13-8-7-9-14-22/h7-9,11,13-16,20,28H,5-6,10,12,17-19H2,1-4H3,(H2,29,31,34) |
| InChIKey | NMLREFBZXBPANR-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|