About 2-[3,5-dichloro-4-[3-[(4-chlorophenyl)methyl]-4-hydroxyphenoxy]anilino]-2-oxoacetic acid
2-[3,5-dichloro-4-[3-[(4-chlorophenyl)methyl]-4-hydroxyphenoxy]anilino]-2-oxoacetic acid (PubChem CID 10367292) has the molecular formula C21H14Cl3NO5
and a molecular weight of 466.70 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[3-[(4-chlorophenyl)methyl]-4-hydroxyphenoxy]anilino]-2-oxoacetic acid.
Molecular Properties
| Compound Name | 2-[3,5-dichloro-4-[3-[(4-chlorophenyl)methyl]-4-hydroxyphenoxy]anilino]-2-oxoacetic acid |
| PubChem CID | 10367292 |
| Molecular Formula | C21H14Cl3NO5 |
| Molecular Weight | 466.70 g/mol |
| Exact Mass | 464.99 |
| IUPAC Name | 2-[3,5-dichloro-4-[3-[(4-chlorophenyl)methyl]-4-hydroxyphenoxy]anilino]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)Nc1cc(Cl)c(Oc2ccc(O)c(Cc3ccc(Cl)cc3)c2)c(Cl)c1 |
| InChI | InChI=1S/C21H14Cl3NO5/c22-13-3-1-11(2-4-13)7-12-8-15(5-6-18(12)26)30-19-16(23)9-14(10-17(19)24)25-20(27)21(28)29/h1-6,8-10,26H,7H2,(H,25,27)(H,28,29) |
| InChIKey | ZGGVWYRGZAGLQW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.70 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,5-dichloro-4-[3-[(4-chlorophenyl)methyl]-4-hydroxyphenoxy]anilino]-2-oxoacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-dichloro-4-[3-[(4-chlorophenyl)methyl]-4-hydroxyphenoxy]anilino]-2-oxoacetic acid?
The IUPAC name of 2-[3,5-dichloro-4-[3-[(4-chlorophenyl)methyl]-4-hydroxyphenoxy]anilino]-2-oxoacetic acid (CID 10367292) is 2-[3,5-dichloro-4-[3-[(4-chlorophenyl)methyl]-4-hydroxyphenoxy]anilino]-2-oxoacetic acid.
What is the SMILES notation for 2-[3,5-dichloro-4-[3-[(4-chlorophenyl)methyl]-4-hydroxyphenoxy]anilino]-2-oxoacetic acid?
The canonical SMILES for 2-[3,5-dichloro-4-[3-[(4-chlorophenyl)methyl]-4-hydroxyphenoxy]anilino]-2-oxoacetic acid is O=C(O)C(=O)Nc1cc(Cl)c(Oc2ccc(O)c(Cc3ccc(Cl)cc3)c2)c(Cl)c1.
What is the InChIKey of 2-[3,5-dichloro-4-[3-[(4-chlorophenyl)methyl]-4-hydroxyphenoxy]anilino]-2-oxoacetic acid?
The InChIKey is ZGGVWYRGZAGLQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14Cl3NO5/c22-13-3-1-11(2-4-13)7-12-8-15(5-6-18(12)26)30-19-16(23)9-14(10-17(19)24)25-20(27)21(28)29/h1-6,8-10,26H,7H2,(H,25,27)(H,28,29).
What are the key properties of 2-[3,5-dichloro-4-[3-[(4-chlorophenyl)methyl]-4-hydroxyphenoxy]anilino]-2-oxoacetic acid?
2-[3,5-dichloro-4-[3-[(4-chlorophenyl)methyl]-4-hydroxyphenoxy]anilino]-2-oxoacetic acid has a molecular weight of 466.70 g/mol, XLogP of 5.76, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-dichloro-4-[3-[(4-chlorophenyl)methyl]-4-hydroxyphenoxy]anilino]-2-oxoacetic acid is sourced from PubChem (CID 10367292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).