C10H16N4O2S — CID 103674941
6-[(3-methylsulfanylcyclohexyl)amino]-2H-1,2,4-triazine-3,5-dione (PubChem CID 103674941) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is 6-[(3-methylsulfanylcyclohexyl)amino]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[(3-methylsulfanylcyclohexyl)amino]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 103674941 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 6-[(3-methylsulfanylcyclohexyl)amino]-2H-1,2,4-triazine-3,5-dione |
| SMILES | CSC1CCCC(Nc2n[nH]c(=O)[nH]c2=O)C1 |
| InChI | InChI=1S/C10H16N4O2S/c1-17-7-4-2-3-6(5-7)11-8-9(15)12-10(16)14-13-8/h6-7H,2-5H2,1H3,(H,11,13)(H2,12,14,15,16) |
| InChIKey | DJVOWDABQWILCU-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |