C18H22F3N7O5 — CID 10367578
2-[(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)amino]acetic acid;2,2,2-trifluoroacetic acid (PubChem CID 10367578) has the molecular formula C18H22F3N7O5 and a molecular weight of 473.41 g/mol. Its IUPAC name is 2-[(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)amino]acetic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)amino]acetic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 10367578 |
| Molecular Formula | C18H22F3N7O5 |
| Molecular Weight | 473.41 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 2-[(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)amino]acetic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(NCC(=O)O)n(C)c(=O)c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H21N7O3.C2HF3O2/c1-3-4-7-23-12-13(20-16(23)22-8-5-17-6-9-22)19-15(18-10-11(24)25)21(2)14(12)26;3-2(4,5)1(6)7/h17H,5-10H2,1-2H3,(H,18,19)(H,24,25);(H,6,7) |
| InChIKey | IHXHLLBDLKUPTC-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.41 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|