C28H27NO4S — CID 10367597
3-[3-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]phenyl]propanoic acid (PubChem CID 10367597) has the molecular formula C28H27NO4S and a molecular weight of 473.59 g/mol. Its IUPAC name is 3-[3-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]phenyl]propanoic acid.
| Compound Name | 3-[3-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 10367597 |
| Molecular Formula | C28H27NO4S |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 3-[3-[3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]phenyl]phenyl]propanoic acid |
| SMILES | CC(C)(c1cc(-c2cccc(-c3cccc(CCC(=O)O)c3)c2)c2ncccc2c1)S(C)(=O)=O |
| InChI | InChI=1S/C28H27NO4S/c1-28(2,34(3,32)33)24-17-23-11-6-14-29-27(23)25(18-24)22-10-5-9-21(16-22)20-8-4-7-19(15-20)12-13-26(30)31/h4-11,14-18H,12-13H2,1-3H3,(H,30,31) |
| InChIKey | CTVCUCKNSAOAOB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |