About tert-butyl N-[2-(1,2,4-oxadiazol-3-yl)ethyl]carbamate
tert-butyl N-[2-(1,2,4-oxadiazol-3-yl)ethyl]carbamate (PubChem CID 103678448) has the molecular formula C9H15N3O3
and a molecular weight of 213.24 g/mol. Its IUPAC name is tert-butyl N-[2-(1,2,4-oxadiazol-3-yl)ethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-(1,2,4-oxadiazol-3-yl)ethyl]carbamate |
| PubChem CID | 103678448 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | tert-butyl N-[2-(1,2,4-oxadiazol-3-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1ncon1 |
| InChI | InChI=1S/C9H15N3O3/c1-9(2,3)15-8(13)10-5-4-7-11-6-14-12-7/h6H,4-5H2,1-3H3,(H,10,13) |
| InChIKey | LKFBTMYQMCBXKS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl N-[2-(1,2,4-oxadiazol-3-yl)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-(1,2,4-oxadiazol-3-yl)ethyl]carbamate?
The IUPAC name of tert-butyl N-[2-(1,2,4-oxadiazol-3-yl)ethyl]carbamate (CID 103678448) is tert-butyl N-[2-(1,2,4-oxadiazol-3-yl)ethyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-(1,2,4-oxadiazol-3-yl)ethyl]carbamate?
The canonical SMILES for tert-butyl N-[2-(1,2,4-oxadiazol-3-yl)ethyl]carbamate is CC(C)(C)OC(=O)NCCc1ncon1.
What is the InChIKey of tert-butyl N-[2-(1,2,4-oxadiazol-3-yl)ethyl]carbamate?
The InChIKey is LKFBTMYQMCBXKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O3/c1-9(2,3)15-8(13)10-5-4-7-11-6-14-12-7/h6H,4-5H2,1-3H3,(H,10,13).
What are the key properties of tert-butyl N-[2-(1,2,4-oxadiazol-3-yl)ethyl]carbamate?
tert-butyl N-[2-(1,2,4-oxadiazol-3-yl)ethyl]carbamate has a molecular weight of 213.24 g/mol, XLogP of 1.14, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-(1,2,4-oxadiazol-3-yl)ethyl]carbamate is sourced from PubChem (CID 103678448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).