C26H19NO4 — CID 1036789
(15R,19S)-17-(1,3-benzodioxol-5-yl)-1-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 1036789) has the molecular formula C26H19NO4 and a molecular weight of 409.44 g/mol. Its IUPAC name is (15R,19S)-17-(1,3-benzodioxol-5-yl)-1-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,19S)-17-(1,3-benzodioxol-5-yl)-1-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 1036789 |
| Molecular Formula | C26H19NO4 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (15R,19S)-17-(1,3-benzodioxol-5-yl)-1-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | CC12c3ccccc3C(c3ccccc31)[C@@H]1C(=O)N(c3ccc4c(c3)OCO4)C(=O)[C@H]12 |
| InChI | InChI=1S/C26H19NO4/c1-26-17-8-4-2-6-15(17)21(16-7-3-5-9-18(16)26)22-23(26)25(29)27(24(22)28)14-10-11-19-20(12-14)31-13-30-19/h2-12,21-23H,13H2,1H3/t21?,22-,23-,26?/m0/s1 |
| InChIKey | CVEGDIZBQJTGHI-ZQFKLAOWSA-N |
| XLogP | 3.99 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|