C29H26N2O5 — CID 10367979
2-[10-[4-(1-methylindol-3-yl)-2,5-dioxofuran-3-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-yl]ethyl acetate (PubChem CID 10367979) has the molecular formula C29H26N2O5 and a molecular weight of 482.54 g/mol. Its IUPAC name is 2-[10-[4-(1-methylindol-3-yl)-2,5-dioxofuran-3-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-yl]ethyl acetate.
| Compound Name | 2-[10-[4-(1-methylindol-3-yl)-2,5-dioxofuran-3-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-yl]ethyl acetate |
|---|---|
| PubChem CID | 10367979 |
| Molecular Formula | C29H26N2O5 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 2-[10-[4-(1-methylindol-3-yl)-2,5-dioxofuran-3-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-7-yl]ethyl acetate |
| SMILES | CC(=O)OCCC1CCc2c(C3=C(c4cn(C)c5ccccc45)C(=O)OC3=O)c3ccccc3n2C1 |
| InChI | InChI=1S/C29H26N2O5/c1-17(32)35-14-13-18-11-12-24-25(20-8-4-6-10-23(20)31(24)15-18)27-26(28(33)36-29(27)34)21-16-30(2)22-9-5-3-7-19(21)22/h3-10,16,18H,11-15H2,1-2H3 |
| InChIKey | PFROXHCLWDHBTI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|