C17H34N2O3 — CID 103680604
tert-butyl 3-[1-[(1-hydroxy-2-methylbutan-2-yl)amino]ethyl]piperidine-1-carboxylate (PubChem CID 103680604) has the molecular formula C17H34N2O3 and a molecular weight of 314.47 g/mol. Its IUPAC name is tert-butyl 3-[1-[(1-hydroxy-2-methylbutan-2-yl)amino]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[1-[(1-hydroxy-2-methylbutan-2-yl)amino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 103680604 |
| Molecular Formula | C17H34N2O3 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | tert-butyl 3-[1-[(1-hydroxy-2-methylbutan-2-yl)amino]ethyl]piperidine-1-carboxylate |
| SMILES | CCC(C)(CO)NC(C)C1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H34N2O3/c1-7-17(6,12-20)18-13(2)14-9-8-10-19(11-14)15(21)22-16(3,4)5/h13-14,18,20H,7-12H2,1-6H3 |
| InChIKey | RUOCBXBNVXWMIN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |