C10H16F3NO2 — CID 103682172
N-(3-ethoxy-2,2-dimethylcyclobutyl)-2,2,2-trifluoroacetamide (PubChem CID 103682172) has the molecular formula C10H16F3NO2 and a molecular weight of 239.24 g/mol. Its IUPAC name is N-(3-ethoxy-2,2-dimethylcyclobutyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(3-ethoxy-2,2-dimethylcyclobutyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 103682172 |
| Molecular Formula | C10H16F3NO2 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | N-(3-ethoxy-2,2-dimethylcyclobutyl)-2,2,2-trifluoroacetamide |
| SMILES | CCOC1CC(NC(=O)C(F)(F)F)C1(C)C |
| InChI | InChI=1S/C10H16F3NO2/c1-4-16-7-5-6(9(7,2)3)14-8(15)10(11,12)13/h6-7H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | SUGTZBGCLMIXTG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |