C28H44O5Si — CID 10368245
[(2E,4S,7E)-3-methyl-8-tri(propan-2-yl)silyloxyocta-2,7-dien-4-yl] (2S)-2-acetyloxy-2-phenylacetate (PubChem CID 10368245) has the molecular formula C28H44O5Si and a molecular weight of 488.74 g/mol. Its IUPAC name is [(2E,4S,7E)-3-methyl-8-tri(propan-2-yl)silyloxyocta-2,7-dien-4-yl] (2S)-2-acetyloxy-2-phenylacetate.
| Compound Name | [(2E,4S,7E)-3-methyl-8-tri(propan-2-yl)silyloxyocta-2,7-dien-4-yl] (2S)-2-acetyloxy-2-phenylacetate |
|---|---|
| PubChem CID | 10368245 |
| Molecular Formula | C28H44O5Si |
| Molecular Weight | 488.74 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | [(2E,4S,7E)-3-methyl-8-tri(propan-2-yl)silyloxyocta-2,7-dien-4-yl] (2S)-2-acetyloxy-2-phenylacetate |
| SMILES | C/C=C(\C)[C@H](CC/C=C/O[Si](C(C)C)(C(C)C)C(C)C)OC(=O)[C@@H](OC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C28H44O5Si/c1-10-23(8)26(18-14-15-19-31-34(20(2)3,21(4)5)22(6)7)33-28(30)27(32-24(9)29)25-16-12-11-13-17-25/h10-13,15-17,19-22,26-27H,14,18H2,1-9H3/b19-15+,23-10+/t26-,27-/m0/s1 |
| InChIKey | FFHMHCWUJQJVPA-BECFTPLNSA-N |
| XLogP | 7.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.74 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|