C30H34N2O2 — CID 10368334
N-[(1S,2S)-7-hydroxy-2-pyrrolidin-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methyl-3,3-diphenylpropanamide (PubChem CID 10368334) has the molecular formula C30H34N2O2 and a molecular weight of 454.61 g/mol. Its IUPAC name is N-[(1S,2S)-7-hydroxy-2-pyrrolidin-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methyl-3,3-diphenylpropanamide.
| Compound Name | N-[(1S,2S)-7-hydroxy-2-pyrrolidin-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methyl-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 10368334 |
| Molecular Formula | C30H34N2O2 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | N-[(1S,2S)-7-hydroxy-2-pyrrolidin-1-yl-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methyl-3,3-diphenylpropanamide |
| SMILES | CN(C(=O)CC(c1ccccc1)c1ccccc1)[C@H]1c2cc(O)ccc2CC[C@@H]1N1CCCC1 |
| InChI | InChI=1S/C30H34N2O2/c1-31(29(34)21-26(22-10-4-2-5-11-22)23-12-6-3-7-13-23)30-27-20-25(33)16-14-24(27)15-17-28(30)32-18-8-9-19-32/h2-7,10-14,16,20,26,28,30,33H,8-9,15,17-19,21H2,1H3/t28-,30-/m0/s1 |
| InChIKey | CQHOKMJAIZEXOW-JDXGNMNLSA-N |
| XLogP | 5.52 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |