C25H38O6SSi — CID 10368500
(1R,4R,7S,8S)-7-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-8-methoxy-4-(4-methylphenyl)sulfonyl-2-oxabicyclo[2.2.2]oct-5-en-3-one (PubChem CID 10368500) has the molecular formula C25H38O6SSi and a molecular weight of 494.73 g/mol. Its IUPAC name is (1R,4R,7S,8S)-7-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-8-methoxy-4-(4-methylphenyl)sulfonyl-2-oxabicyclo[2.2.2]oct-5-en-3-one.
| Compound Name | (1R,4R,7S,8S)-7-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-8-methoxy-4-(4-methylphenyl)sulfonyl-2-oxabicyclo[2.2.2]oct-5-en-3-one |
|---|---|
| PubChem CID | 10368500 |
| Molecular Formula | C25H38O6SSi |
| Molecular Weight | 494.73 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | (1R,4R,7S,8S)-7-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-8-methoxy-4-(4-methylphenyl)sulfonyl-2-oxabicyclo[2.2.2]oct-5-en-3-one |
| SMILES | CO[C@H]1[C@@H](CCCCO[Si](C)(C)C(C)(C)C)[C@H]2C=C[C@]1(S(=O)(=O)c1ccc(C)cc1)C(=O)O2 |
| InChI | InChI=1S/C25H38O6SSi/c1-18-11-13-19(14-12-18)32(27,28)25-16-15-21(31-23(25)26)20(22(25)29-5)10-8-9-17-30-33(6,7)24(2,3)4/h11-16,20-22H,8-10,17H2,1-7H3/t20-,21+,22-,25+/m0/s1 |
| InChIKey | UDODVXRSYPTTAO-XOEOCAAJSA-N |
| XLogP | 4.83 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.73 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|