C22H27F3N6O4 — CID 10368554
N-benzyl-2-[2-[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxamide (PubChem CID 10368554) has the molecular formula C22H27F3N6O4 and a molecular weight of 496.49 g/mol. Its IUPAC name is N-benzyl-2-[2-[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxamide.
| Compound Name | N-benzyl-2-[2-[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 10368554 |
| Molecular Formula | C22H27F3N6O4 |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | N-benzyl-2-[2-[(2R)-2-[[formyl(hydroxy)amino]methyl]heptanoyl]hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxamide |
| SMILES | CCCCC[C@H](CN(O)C=O)C(=O)NNc1ncc(C(=O)NCc2ccccc2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C22H27F3N6O4/c1-2-3-5-10-16(13-31(35)14-32)19(33)29-30-21-27-12-17(18(28-21)22(23,24)25)20(34)26-11-15-8-6-4-7-9-15/h4,6-9,12,14,16,35H,2-3,5,10-11,13H2,1H3,(H,26,34)(H,29,33)(H,27,28,30)/t16-/m1/s1 |
| InChIKey | GZYMPCLTLIEEFE-MRXNPFEDSA-N |
| XLogP | 2.91 |
| TPSA | 136.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|