C8H8F3NO3 — CID 103686829
3-(3,3,3-trifluoro-2-hydroxypropyl)-3-azabicyclo[3.1.0]hexane-2,4-dione (PubChem CID 103686829) has the molecular formula C8H8F3NO3 and a molecular weight of 223.15 g/mol. Its IUPAC name is 3-(3,3,3-trifluoro-2-hydroxypropyl)-3-azabicyclo[3.1.0]hexane-2,4-dione.
| Compound Name | 3-(3,3,3-trifluoro-2-hydroxypropyl)-3-azabicyclo[3.1.0]hexane-2,4-dione |
|---|---|
| PubChem CID | 103686829 |
| Molecular Formula | C8H8F3NO3 |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 3-(3,3,3-trifluoro-2-hydroxypropyl)-3-azabicyclo[3.1.0]hexane-2,4-dione |
| SMILES | O=C1C2CC2C(=O)N1CC(O)C(F)(F)F |
| InChI | InChI=1S/C8H8F3NO3/c9-8(10,11)5(13)2-12-6(14)3-1-4(3)7(12)15/h3-5,13H,1-2H2 |
| InChIKey | PCUUUOLVNWBNFV-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|