C10H8Cl3N3S — CID 103688413
5-methyl-N-[(2,3,6-trichlorophenyl)methyl]-1,3,4-thiadiazol-2-amine (PubChem CID 103688413) has the molecular formula C10H8Cl3N3S and a molecular weight of 308.62 g/mol. Its IUPAC name is 5-methyl-N-[(2,3,6-trichlorophenyl)methyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-methyl-N-[(2,3,6-trichlorophenyl)methyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 103688413 |
| Molecular Formula | C10H8Cl3N3S |
| Molecular Weight | 308.62 g/mol |
| Exact Mass | 306.95 |
| IUPAC Name | 5-methyl-N-[(2,3,6-trichlorophenyl)methyl]-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1nnc(NCc2c(Cl)ccc(Cl)c2Cl)s1 |
| InChI | InChI=1S/C10H8Cl3N3S/c1-5-15-16-10(17-5)14-4-6-7(11)2-3-8(12)9(6)13/h2-3H,4H2,1H3,(H,14,16) |
| InChIKey | VVHZBQPOYVPVLJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|