C10H8F2O2 — CID 103689349
5-(3,5-difluorophenyl)oxolan-2-one (PubChem CID 103689349) has the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. Its IUPAC name is 5-(3,5-difluorophenyl)oxolan-2-one.
| Compound Name | 5-(3,5-difluorophenyl)oxolan-2-one |
|---|---|
| PubChem CID | 103689349 |
| Molecular Formula | C10H8F2O2 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 5-(3,5-difluorophenyl)oxolan-2-one |
| SMILES | O=C1CCC(c2cc(F)cc(F)c2)O1 |
| InChI | InChI=1S/C10H8F2O2/c11-7-3-6(4-8(12)5-7)9-1-2-10(13)14-9/h3-5,9H,1-2H2 |
| InChIKey | RPHGVXGUHIWKNS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |