C27H21N7O3S — CID 10369499
11-ethoxy-4-(2-nitrophenyl)-13-phenyl-6-(2-propan-2-ylidenehydrazinyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carbonitrile (PubChem CID 10369499) has the molecular formula C27H21N7O3S and a molecular weight of 523.58 g/mol. Its IUPAC name is 11-ethoxy-4-(2-nitrophenyl)-13-phenyl-6-(2-propan-2-ylidenehydrazinyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carbonitrile.
| Compound Name | 11-ethoxy-4-(2-nitrophenyl)-13-phenyl-6-(2-propan-2-ylidenehydrazinyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carbonitrile |
|---|---|
| PubChem CID | 10369499 |
| Molecular Formula | C27H21N7O3S |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 11-ethoxy-4-(2-nitrophenyl)-13-phenyl-6-(2-propan-2-ylidenehydrazinyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-12-carbonitrile |
| SMILES | CCOc1nc2sc3c(NN=C(C)C)nc(-c4ccccc4[N+](=O)[O-])nc3c2c(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C27H21N7O3S/c1-4-37-26-18(14-28)20(16-10-6-5-7-11-16)21-22-23(38-27(21)31-26)25(33-32-15(2)3)30-24(29-22)17-12-8-9-13-19(17)34(35)36/h5-13H,4H2,1-3H3,(H,29,30,33) |
| InChIKey | HQECGLCUMDSQPP-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 139.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|