C12H17N3O5 — CID 103696574
3-(2,4-dinitroanilino)-4-methylpentan-1-ol (PubChem CID 103696574) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is 3-(2,4-dinitroanilino)-4-methylpentan-1-ol.
| Compound Name | 3-(2,4-dinitroanilino)-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 103696574 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3-(2,4-dinitroanilino)-4-methylpentan-1-ol |
| SMILES | CC(C)C(CCO)Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17N3O5/c1-8(2)10(5-6-16)13-11-4-3-9(14(17)18)7-12(11)15(19)20/h3-4,7-8,10,13,16H,5-6H2,1-2H3 |
| InChIKey | NSPKAMOFDBOLMZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|