C14H21ClN2O — CID 103698697
N-(4-chlorophenyl)-2-(2,2-dimethylbutylamino)acetamide (PubChem CID 103698697) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(2,2-dimethylbutylamino)acetamide.
| Compound Name | N-(4-chlorophenyl)-2-(2,2-dimethylbutylamino)acetamide |
|---|---|
| PubChem CID | 103698697 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | N-(4-chlorophenyl)-2-(2,2-dimethylbutylamino)acetamide |
| SMILES | CCC(C)(C)CNCC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H21ClN2O/c1-4-14(2,3)10-16-9-13(18)17-12-7-5-11(15)6-8-12/h5-8,16H,4,9-10H2,1-3H3,(H,17,18) |
| InChIKey | JHTDKJQXMDESAV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |