C10H14N4OS — CID 103699697
2-[(1-methyltriazol-4-yl)methylamino]-1-thiophen-3-ylethanol (PubChem CID 103699697) has the molecular formula C10H14N4OS and a molecular weight of 238.32 g/mol. Its IUPAC name is 2-[(1-methyltriazol-4-yl)methylamino]-1-thiophen-3-ylethanol.
| Compound Name | 2-[(1-methyltriazol-4-yl)methylamino]-1-thiophen-3-ylethanol |
|---|---|
| PubChem CID | 103699697 |
| Molecular Formula | C10H14N4OS |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 2-[(1-methyltriazol-4-yl)methylamino]-1-thiophen-3-ylethanol |
| SMILES | Cn1cc(CNCC(O)c2ccsc2)nn1 |
| InChI | InChI=1S/C10H14N4OS/c1-14-6-9(12-13-14)4-11-5-10(15)8-2-3-16-7-8/h2-3,6-7,10-11,15H,4-5H2,1H3 |
| InChIKey | NHQWGKKUBPGWLL-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |