C18H28N2O — CID 103699820
3-[[(4-pyrrolidin-1-ylphenyl)methylamino]methyl]cyclohexan-1-ol (PubChem CID 103699820) has the molecular formula C18H28N2O and a molecular weight of 288.43 g/mol. Its IUPAC name is 3-[[(4-pyrrolidin-1-ylphenyl)methylamino]methyl]cyclohexan-1-ol.
| Compound Name | 3-[[(4-pyrrolidin-1-ylphenyl)methylamino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 103699820 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 3-[[(4-pyrrolidin-1-ylphenyl)methylamino]methyl]cyclohexan-1-ol |
| SMILES | OC1CCCC(CNCc2ccc(N3CCCC3)cc2)C1 |
| InChI | InChI=1S/C18H28N2O/c21-18-5-3-4-16(12-18)14-19-13-15-6-8-17(9-7-15)20-10-1-2-11-20/h6-9,16,18-19,21H,1-5,10-14H2 |
| InChIKey | UHUQRJCFGHCDLF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|