C14H21N — CID 103700096
2-cyclopropyl-N-[(4-methylphenyl)methyl]propan-2-amine (PubChem CID 103700096) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(4-methylphenyl)methyl]propan-2-amine.
| Compound Name | 2-cyclopropyl-N-[(4-methylphenyl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 103700096 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 2-cyclopropyl-N-[(4-methylphenyl)methyl]propan-2-amine |
| SMILES | Cc1ccc(CNC(C)(C)C2CC2)cc1 |
| InChI | InChI=1S/C14H21N/c1-11-4-6-12(7-5-11)10-15-14(2,3)13-8-9-13/h4-7,13,15H,8-10H2,1-3H3 |
| InChIKey | BSLGKJHJVLVYCD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |