About N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]methanamine
N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]methanamine (PubChem CID 103701913) has the molecular formula C14H15F3N2OS
and a molecular weight of 316.35 g/mol. Its IUPAC name is N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]methanamine.
Molecular Properties
| Compound Name | N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]methanamine |
| PubChem CID | 103701913 |
| Molecular Formula | C14H15F3N2OS |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]methanamine |
| SMILES | CCc1cnc(CNCc2ccc(OC(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C14H15F3N2OS/c1-2-12-8-19-13(21-12)9-18-7-10-3-5-11(6-4-10)20-14(15,16)17/h3-6,8,18H,2,7,9H2,1H3 |
| InChIKey | CSIPKSJVKOVBAY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]methanamine?
The IUPAC name of N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]methanamine (CID 103701913) is N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]methanamine.
What is the SMILES notation for N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]methanamine?
The canonical SMILES for N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]methanamine is CCc1cnc(CNCc2ccc(OC(F)(F)F)cc2)s1.
What is the InChIKey of N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]methanamine?
The InChIKey is CSIPKSJVKOVBAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F3N2OS/c1-2-12-8-19-13(21-12)9-18-7-10-3-5-11(6-4-10)20-14(15,16)17/h3-6,8,18H,2,7,9H2,1H3.
What are the key properties of N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]methanamine?
N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]methanamine has a molecular weight of 316.35 g/mol, XLogP of 3.89, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1-[4-(trifluoromethoxy)phenyl]methanamine is sourced from PubChem (CID 103701913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).