C30H39N7O3 — CID 10370207
8-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-1,3-dimethyl-7-(3-phenylpropyl)purine-2,6-dione (PubChem CID 10370207) has the molecular formula C30H39N7O3 and a molecular weight of 545.69 g/mol. Its IUPAC name is 8-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-1,3-dimethyl-7-(3-phenylpropyl)purine-2,6-dione.
| Compound Name | 8-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-1,3-dimethyl-7-(3-phenylpropyl)purine-2,6-dione |
|---|---|
| PubChem CID | 10370207 |
| Molecular Formula | C30H39N7O3 |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.31 |
| IUPAC Name | 8-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propylamino]-1,3-dimethyl-7-(3-phenylpropyl)purine-2,6-dione |
| SMILES | COc1ccccc1N1CCN(CCCNc2nc3c(c(=O)n(C)c(=O)n3C)n2CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C30H39N7O3/c1-33-27-26(28(38)34(2)30(33)39)37(18-9-13-23-11-5-4-6-12-23)29(32-27)31-16-10-17-35-19-21-36(22-20-35)24-14-7-8-15-25(24)40-3/h4-8,11-12,14-15H,9-10,13,16-22H2,1-3H3,(H,31,32) |
| InChIKey | IKDXYIQGRUNDAZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 89.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|