C11H14N2S — CID 103703360
5-methyl-N-(2-prop-2-ynylsulfanylethyl)pyridin-2-amine (PubChem CID 103703360) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 5-methyl-N-(2-prop-2-ynylsulfanylethyl)pyridin-2-amine.
| Compound Name | 5-methyl-N-(2-prop-2-ynylsulfanylethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 103703360 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 5-methyl-N-(2-prop-2-ynylsulfanylethyl)pyridin-2-amine |
| SMILES | C#CCSCCNc1ccc(C)cn1 |
| InChI | InChI=1S/C11H14N2S/c1-3-7-14-8-6-12-11-5-4-10(2)9-13-11/h1,4-5,9H,6-8H2,2H3,(H,12,13) |
| InChIKey | LZFBQNAMDCOWNF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|