C12H9Br5 — CID 10370378
(1R,8S,10R,11R,12R)-9,9,10,11,12-pentabromotricyclo[6.2.2.02,7]dodeca-2,4,6-triene (PubChem CID 10370378) has the molecular formula C12H9Br5 and a molecular weight of 552.72 g/mol. Its IUPAC name is (1R,8S,10R,11R,12R)-9,9,10,11,12-pentabromotricyclo[6.2.2.02,7]dodeca-2,4,6-triene.
| Compound Name | (1R,8S,10R,11R,12R)-9,9,10,11,12-pentabromotricyclo[6.2.2.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 10370378 |
| Molecular Formula | C12H9Br5 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 547.66 |
| IUPAC Name | (1R,8S,10R,11R,12R)-9,9,10,11,12-pentabromotricyclo[6.2.2.02,7]dodeca-2,4,6-triene |
| SMILES | Br[C@H]1[C@H](Br)[C@@H]2c3ccccc3[C@H]1[C@@H](Br)C2(Br)Br |
| InChI | InChI=1S/C12H9Br5/c13-9-7-5-3-1-2-4-6(5)8(10(9)14)12(16,17)11(7)15/h1-4,7-11H/t7-,8+,9-,10-,11-/m1/s1 |
| InChIKey | ZLAKFQXVMVGEPP-RCZSTQMZSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|