C15H16N4S — CID 103704215
4-[(3-methylsulfanylcyclopentyl)amino]cinnoline-3-carbonitrile (PubChem CID 103704215) has the molecular formula C15H16N4S and a molecular weight of 284.39 g/mol. Its IUPAC name is 4-[(3-methylsulfanylcyclopentyl)amino]cinnoline-3-carbonitrile.
| Compound Name | 4-[(3-methylsulfanylcyclopentyl)amino]cinnoline-3-carbonitrile |
|---|---|
| PubChem CID | 103704215 |
| Molecular Formula | C15H16N4S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 4-[(3-methylsulfanylcyclopentyl)amino]cinnoline-3-carbonitrile |
| SMILES | CSC1CCC(Nc2c(C#N)nnc3ccccc23)C1 |
| InChI | InChI=1S/C15H16N4S/c1-20-11-7-6-10(8-11)17-15-12-4-2-3-5-13(12)18-19-14(15)9-16/h2-5,10-11H,6-8H2,1H3,(H,17,18) |
| InChIKey | XTYBLRWSZDDYAJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |