C36H58O4 — CID 10370429
2,4,6-tritert-butyl-6-(1,3,5-tritert-butyl-4-oxocyclohexa-2,5-dien-1-yl)peroxycyclohexa-2,4-dien-1-one (PubChem CID 10370429) has the molecular formula C36H58O4 and a molecular weight of 554.86 g/mol. Its IUPAC name is 2,4,6-tritert-butyl-6-(1,3,5-tritert-butyl-4-oxocyclohexa-2,5-dien-1-yl)peroxycyclohexa-2,4-dien-1-one.
| Compound Name | 2,4,6-tritert-butyl-6-(1,3,5-tritert-butyl-4-oxocyclohexa-2,5-dien-1-yl)peroxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 10370429 |
| Molecular Formula | C36H58O4 |
| Molecular Weight | 554.86 g/mol |
| Exact Mass | 554.43 |
| IUPAC Name | 2,4,6-tritert-butyl-6-(1,3,5-tritert-butyl-4-oxocyclohexa-2,5-dien-1-yl)peroxycyclohexa-2,4-dien-1-one |
| SMILES | CC(C)(C)C1=CC(OOC2(C(C)(C)C)C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C2)(C(C)(C)C)C(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C36H58O4/c1-29(2,3)23-19-24(30(4,5)6)28(38)36(20-23,34(16,17)18)40-39-35(33(13,14)15)21-25(31(7,8)9)27(37)26(22-35)32(10,11)12/h19-22H,1-18H3 |
| InChIKey | GJOUIVZJJFJWGZ-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.86 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|