About N-pent-4-ynylthieno[3,2-d]pyrimidin-4-amine
N-pent-4-ynylthieno[3,2-d]pyrimidin-4-amine (PubChem CID 103704438) has the molecular formula C11H11N3S
and a molecular weight of 217.30 g/mol. Its IUPAC name is N-pent-4-ynylthieno[3,2-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-pent-4-ynylthieno[3,2-d]pyrimidin-4-amine |
| PubChem CID | 103704438 |
| Molecular Formula | C11H11N3S |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | N-pent-4-ynylthieno[3,2-d]pyrimidin-4-amine |
| SMILES | C#CCCCNc1ncnc2ccsc12 |
| InChI | InChI=1S/C11H11N3S/c1-2-3-4-6-12-11-10-9(5-7-15-10)13-8-14-11/h1,5,7-8H,3-4,6H2,(H,12,13,14) |
| InChIKey | ODCABBOSKDHLRC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-pent-4-ynylthieno[3,2-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pent-4-ynylthieno[3,2-d]pyrimidin-4-amine?
The IUPAC name of N-pent-4-ynylthieno[3,2-d]pyrimidin-4-amine (CID 103704438) is N-pent-4-ynylthieno[3,2-d]pyrimidin-4-amine.
What is the SMILES notation for N-pent-4-ynylthieno[3,2-d]pyrimidin-4-amine?
The canonical SMILES for N-pent-4-ynylthieno[3,2-d]pyrimidin-4-amine is C#CCCCNc1ncnc2ccsc12.
What is the InChIKey of N-pent-4-ynylthieno[3,2-d]pyrimidin-4-amine?
The InChIKey is ODCABBOSKDHLRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3S/c1-2-3-4-6-12-11-10-9(5-7-15-10)13-8-14-11/h1,5,7-8H,3-4,6H2,(H,12,13,14).
What are the key properties of N-pent-4-ynylthieno[3,2-d]pyrimidin-4-amine?
N-pent-4-ynylthieno[3,2-d]pyrimidin-4-amine has a molecular weight of 217.30 g/mol, XLogP of 2.52, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-pent-4-ynylthieno[3,2-d]pyrimidin-4-amine is sourced from PubChem (CID 103704438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).