C11H10F3N5 — CID 103705063
N-pent-4-yn-2-yl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 103705063) has the molecular formula C11H10F3N5 and a molecular weight of 269.23 g/mol. Its IUPAC name is N-pent-4-yn-2-yl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-pent-4-yn-2-yl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 103705063 |
| Molecular Formula | C11H10F3N5 |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | N-pent-4-yn-2-yl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | C#CCC(C)Nc1ccc2nnc(C(F)(F)F)n2n1 |
| InChI | InChI=1S/C11H10F3N5/c1-3-4-7(2)15-8-5-6-9-16-17-10(11(12,13)14)19(9)18-8/h1,5-7H,4H2,2H3,(H,15,18) |
| InChIKey | UGTWYSBKLQVVNL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|